C20H25NO5 — CID 101458410
benzyl (1R,2S,5R)-3,3-dimethoxy-2-prop-2-enoxy-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate (PubChem CID 101458410) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is benzyl (1R,2S,5R)-3,3-dimethoxy-2-prop-2-enoxy-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate.
| Compound Name | benzyl (1R,2S,5R)-3,3-dimethoxy-2-prop-2-enoxy-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
|---|---|
| PubChem CID | 101458410 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | benzyl (1R,2S,5R)-3,3-dimethoxy-2-prop-2-enoxy-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
| SMILES | C=CCO[C@H]1[C@H]2C=C[C@@H](CC1(OC)OC)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H25NO5/c1-4-12-25-18-17-11-10-16(13-20(18,23-2)24-3)21(17)19(22)26-14-15-8-6-5-7-9-15/h4-11,16-18H,1,12-14H2,2-3H3/t16-,17+,18-/m0/s1 |
| InChIKey | PCFYKSBTYXLXJE-KSZLIROESA-N |
| XLogP | 2.90 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|