C16H18N4O4 — CID 111110636
N-[(1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]-2-(3-nitropyrazol-1-yl)acetamide (PubChem CID 111110636) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[(1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]-2-(3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[(1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]-2-(3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 111110636 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[(1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]-2-(3-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccc([N+](=O)[O-])n1)NCC1(O)CCCc2ccccc21 |
| InChI | InChI=1S/C16H18N4O4/c21-15(10-19-9-7-14(18-19)20(23)24)17-11-16(22)8-3-5-12-4-1-2-6-13(12)16/h1-2,4,6-7,9,22H,3,5,8,10-11H2,(H,17,21) |
| InChIKey | OQLMXPYDQCFFFX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|