C17H24F2N2O3 — CID 111114132
N-[4-(difluoromethoxy)phenyl]-2-[4-(1-hydroxyethyl)piperidin-1-yl]propanamide (PubChem CID 111114132) has the molecular formula C17H24F2N2O3 and a molecular weight of 342.39 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[4-(1-hydroxyethyl)piperidin-1-yl]propanamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[4-(1-hydroxyethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 111114132 |
| Molecular Formula | C17H24F2N2O3 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[4-(1-hydroxyethyl)piperidin-1-yl]propanamide |
| SMILES | CC(O)C1CCN(C(C)C(=O)Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H24F2N2O3/c1-11(21-9-7-13(8-10-21)12(2)22)16(23)20-14-3-5-15(6-4-14)24-17(18)19/h3-6,11-13,17,22H,7-10H2,1-2H3,(H,20,23) |
| InChIKey | IFXMPGHFCPHJDN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |