C16H23F2NO2 — CID 111114276
2-[cyclohexyl(2-hydroxyethyl)amino]-1-(2,4-difluorophenyl)ethanol (PubChem CID 111114276) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-[cyclohexyl(2-hydroxyethyl)amino]-1-(2,4-difluorophenyl)ethanol.
| Compound Name | 2-[cyclohexyl(2-hydroxyethyl)amino]-1-(2,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 111114276 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-[cyclohexyl(2-hydroxyethyl)amino]-1-(2,4-difluorophenyl)ethanol |
| SMILES | OCCN(CC(O)c1ccc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C16H23F2NO2/c17-12-6-7-14(15(18)10-12)16(21)11-19(8-9-20)13-4-2-1-3-5-13/h6-7,10,13,16,20-21H,1-5,8-9,11H2 |
| InChIKey | NNPNKPQGNIQYGQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |