About [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate
[(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate (PubChem CID 11111533) has the molecular formula C21H24FNO4
and a molecular weight of 373.42 g/mol. Its IUPAC name is [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate.
Molecular Properties
| Compound Name | [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate |
| PubChem CID | 11111533 |
| Molecular Formula | C21H24FNO4 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)O[C@@H]1OCCN(Cc2ccccc2)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FNO4/c1-15(2)26-21(24)27-20-19(17-8-10-18(22)11-9-17)23(12-13-25-20)14-16-6-4-3-5-7-16/h3-11,15,19-20H,12-14H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | UOXNGWOKLZOZER-PMACEKPBSA-N |
| XLogP | 4.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate?
The IUPAC name of [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate (CID 11111533) is [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate.
What is the SMILES notation for [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate?
The canonical SMILES for [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate is CC(C)OC(=O)O[C@@H]1OCCN(Cc2ccccc2)[C@H]1c1ccc(F)cc1.
What is the InChIKey of [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate?
The InChIKey is UOXNGWOKLZOZER-PMACEKPBSA-N. The full InChI is InChI=1S/C21H24FNO4/c1-15(2)26-21(24)27-20-19(17-8-10-18(22)11-9-17)23(12-13-25-20)14-16-6-4-3-5-7-16/h3-11,15,19-20H,12-14H2,1-2H3/t19-,20-/m0/s1.
What are the key properties of [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate?
[(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate has a molecular weight of 373.42 g/mol, XLogP of 4.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] propan-2-yl carbonate is sourced from PubChem (CID 11111533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).