C31H33F6NO3 — CID 10531317
(2S,3S)-4-benzyl-2-[4-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]butoxy]-3-phenylmorpholine (PubChem CID 10531317) has the molecular formula C31H33F6NO3 and a molecular weight of 581.60 g/mol. Its IUPAC name is (2S,3S)-4-benzyl-2-[4-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]butoxy]-3-phenylmorpholine.
| Compound Name | (2S,3S)-4-benzyl-2-[4-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]butoxy]-3-phenylmorpholine |
|---|---|
| PubChem CID | 10531317 |
| Molecular Formula | C31H33F6NO3 |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | (2S,3S)-4-benzyl-2-[4-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]butoxy]-3-phenylmorpholine |
| SMILES | CC(OCCCCO[C@H]1OCCN(Cc2ccccc2)[C@H]1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H33F6NO3/c1-22(25-18-26(30(32,33)34)20-27(19-25)31(35,36)37)39-15-8-9-16-40-29-28(24-12-6-3-7-13-24)38(14-17-41-29)21-23-10-4-2-5-11-23/h2-7,10-13,18-20,22,28-29H,8-9,14-17,21H2,1H3/t22?,28-,29-/m0/s1 |
| InChIKey | XHOQGUZFTJBSSK-OEJBOCFZSA-N |
| XLogP | 8.20 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|