C25H27F6NO4 — CID 22860742
6-[(2S,3R)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-phenylmorpholin-4-yl]hexanoic acid (PubChem CID 22860742) has the molecular formula C25H27F6NO4 and a molecular weight of 519.48 g/mol. Its IUPAC name is 6-[(2S,3R)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-phenylmorpholin-4-yl]hexanoic acid.
| Compound Name | 6-[(2S,3R)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-phenylmorpholin-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 22860742 |
| Molecular Formula | C25H27F6NO4 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 6-[(2S,3R)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-phenylmorpholin-4-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1CCO[C@H](OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C25H27F6NO4/c26-24(27,28)19-13-17(14-20(15-19)25(29,30)31)16-36-23-22(18-7-3-1-4-8-18)32(11-12-35-23)10-6-2-5-9-21(33)34/h1,3-4,7-8,13-15,22-23H,2,5-6,9-12,16H2,(H,33,34)/t22?,23-/m1/s1 |
| InChIKey | BJGPOQZAOCLNIE-OZAIVSQSSA-N |
| XLogP | 6.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|