C25H27F7N4O3 — CID 143854211
3-[[2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1,4-dihydro-1,2,4-triazol-5-one;ethane (PubChem CID 143854211) has the molecular formula C25H27F7N4O3 and a molecular weight of 564.50 g/mol. Its IUPAC name is 3-[[2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1,4-dihydro-1,2,4-triazol-5-one;ethane.
| Compound Name | 3-[[2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1,4-dihydro-1,2,4-triazol-5-one;ethane |
|---|---|
| PubChem CID | 143854211 |
| Molecular Formula | C25H27F7N4O3 |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 3-[[2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1,4-dihydro-1,2,4-triazol-5-one;ethane |
| SMILES | CC.C[C@@H](OC1OCCN(Cc2n[nH]c(=O)[nH]2)C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H21F7N4O3.C2H6/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)37-20-19(13-2-4-17(24)5-3-13)34(6-7-36-20)11-18-31-21(35)33-32-18;1-2/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H2,31,32,33,35);1-2H3/t12-,19?,20?;/m1./s1 |
| InChIKey | VIDONPLYCQQVOS-YOXFIEJESA-N |
| XLogP | 5.98 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |