C31H30F7N5O2 — CID 158708508
2-[5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1H-1,2,4-triazol-3-yl]-N,N-dimethylaniline (PubChem CID 158708508) has the molecular formula C31H30F7N5O2 and a molecular weight of 637.60 g/mol. Its IUPAC name is 2-[5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1H-1,2,4-triazol-3-yl]-N,N-dimethylaniline.
| Compound Name | 2-[5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1H-1,2,4-triazol-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 158708508 |
| Molecular Formula | C31H30F7N5O2 |
| Molecular Weight | 637.60 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | 2-[5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1H-1,2,4-triazol-3-yl]-N,N-dimethylaniline |
| SMILES | C[C@@H](O[C@H]1OCCN(Cc2nc(-c3ccccc3N(C)C)n[nH]2)C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H30F7N5O2/c1-18(20-14-21(30(33,34)35)16-22(15-20)31(36,37)38)45-29-27(19-8-10-23(32)11-9-19)43(12-13-44-29)17-26-39-28(41-40-26)24-6-4-5-7-25(24)42(2)3/h4-11,14-16,18,27,29H,12-13,17H2,1-3H3,(H,39,40,41)/t18-,27?,29-/m1/s1 |
| InChIKey | IIKQIEBRWRRSBL-PYXKCFJMSA-N |
| XLogP | 7.39 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.60 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |