C24H25F7N4O4 — CID 11455865
methyl N-[(Z)-[1-amino-2-[(2S,3R)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl](114C)ethylidene]amino]carbamate (PubChem CID 11455865) has the molecular formula C24H25F7N4O4 and a molecular weight of 568.47 g/mol. Its IUPAC name is methyl N-[(Z)-[1-amino-2-[(2S,3R)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl](114C)ethylidene]amino]carbamate.
| Compound Name | methyl N-[(Z)-[1-amino-2-[(2S,3R)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl](114C)ethylidene]amino]carbamate |
|---|---|
| PubChem CID | 11455865 |
| Molecular Formula | C24H25F7N4O4 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | methyl N-[(Z)-[1-amino-2-[(2S,3R)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl](114C)ethylidene]amino]carbamate |
| SMILES | COC(=O)N/N=[14C](\N)CN1CCO[C@@H](O[C@@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25F7N4O4/c1-13(15-9-16(23(26,27)28)11-17(10-15)24(29,30)31)39-21-20(14-3-5-18(25)6-4-14)35(7-8-38-21)12-19(32)33-34-22(36)37-2/h3-6,9-11,13,20-21H,7-8,12H2,1-2H3,(H2,32,33)(H,34,36)/t13-,20?,21-/m0/s1/i19+2 |
| InChIKey | JMBSYJOVXPFTFD-WZWKFAGSSA-N |
| XLogP | 4.97 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|