C26H28F4N2O2 — CID 56998474
4-[4-(azetidin-1-yl)but-2-ynyl]-3-(4-fluorophenyl)-2-[1-[3-(trifluoromethyl)phenyl]ethoxy]morpholine (PubChem CID 56998474) has the molecular formula C26H28F4N2O2 and a molecular weight of 476.51 g/mol. Its IUPAC name is 4-[4-(azetidin-1-yl)but-2-ynyl]-3-(4-fluorophenyl)-2-[1-[3-(trifluoromethyl)phenyl]ethoxy]morpholine.
| Compound Name | 4-[4-(azetidin-1-yl)but-2-ynyl]-3-(4-fluorophenyl)-2-[1-[3-(trifluoromethyl)phenyl]ethoxy]morpholine |
|---|---|
| PubChem CID | 56998474 |
| Molecular Formula | C26H28F4N2O2 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 4-[4-(azetidin-1-yl)but-2-ynyl]-3-(4-fluorophenyl)-2-[1-[3-(trifluoromethyl)phenyl]ethoxy]morpholine |
| SMILES | CC(OC1OCCN(CC#CCN2CCC2)C1c1ccc(F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H28F4N2O2/c1-19(21-6-4-7-22(18-21)26(28,29)30)34-25-24(20-8-10-23(27)11-9-20)32(16-17-33-25)15-3-2-12-31-13-5-14-31/h4,6-11,18-19,24-25H,5,12-17H2,1H3 |
| InChIKey | ZQBPZVMNIQMIJV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|