C26H28F4N2O2 — CID 70198464
4-[1-(azetidin-2-yl)but-2-ynyl]-3-(4-fluorophenyl)-2-[(1R)-1-[3-(trifluoromethyl)phenyl]ethoxy]morpholine (PubChem CID 70198464) has the molecular formula C26H28F4N2O2 and a molecular weight of 476.51 g/mol. Its IUPAC name is 4-[1-(azetidin-2-yl)but-2-ynyl]-3-(4-fluorophenyl)-2-[(1R)-1-[3-(trifluoromethyl)phenyl]ethoxy]morpholine.
| Compound Name | 4-[1-(azetidin-2-yl)but-2-ynyl]-3-(4-fluorophenyl)-2-[(1R)-1-[3-(trifluoromethyl)phenyl]ethoxy]morpholine |
|---|---|
| PubChem CID | 70198464 |
| Molecular Formula | C26H28F4N2O2 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 4-[1-(azetidin-2-yl)but-2-ynyl]-3-(4-fluorophenyl)-2-[(1R)-1-[3-(trifluoromethyl)phenyl]ethoxy]morpholine |
| SMILES | CC#CC(C1CCN1)N1CCOC(O[C@H](C)c2cccc(C(F)(F)F)c2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28F4N2O2/c1-3-5-23(22-12-13-31-22)32-14-15-33-25(24(32)18-8-10-21(27)11-9-18)34-17(2)19-6-4-7-20(16-19)26(28,29)30/h4,6-11,16-17,22-25,31H,12-15H2,1-2H3/t17-,22?,23?,24?,25?/m1/s1 |
| InChIKey | KWYHKLITFPEASJ-OVPKROOUSA-N |
| XLogP | 5.08 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|