C24H21F7N4O2 — CID 11114153
(2R,3S)-4-(4-azidobut-2-ynyl)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine (PubChem CID 11114153) has the molecular formula C24H21F7N4O2 and a molecular weight of 530.44 g/mol. Its IUPAC name is (2R,3S)-4-(4-azidobut-2-ynyl)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine.
| Compound Name | (2R,3S)-4-(4-azidobut-2-ynyl)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine |
|---|---|
| PubChem CID | 11114153 |
| Molecular Formula | C24H21F7N4O2 |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | (2R,3S)-4-(4-azidobut-2-ynyl)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine |
| SMILES | C[C@@H](O[C@H]1OCCN(CC#CCN=[N+]=[N-])C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F7N4O2/c1-15(17-12-18(23(26,27)28)14-19(13-17)24(29,30)31)37-22-21(16-4-6-20(25)7-5-16)35(10-11-36-22)9-3-2-8-33-34-32/h4-7,12-15,21-22H,8-11H2,1H3/t15-,21?,22-/m1/s1 |
| InChIKey | WDPABLGLTMNYIY-WWFGYZFLSA-N |
| XLogP | 6.65 |
| TPSA | 70.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|