C23H23F7N4O3 — CID 143854196
(Z)-[1-amino-2-[(2S,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]ethylidene]urea (PubChem CID 143854196) has the molecular formula C23H23F7N4O3 and a molecular weight of 536.45 g/mol. Its IUPAC name is (Z)-[1-amino-2-[(2S,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]ethylidene]urea.
| Compound Name | (Z)-[1-amino-2-[(2S,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]ethylidene]urea |
|---|---|
| PubChem CID | 143854196 |
| Molecular Formula | C23H23F7N4O3 |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (Z)-[1-amino-2-[(2S,3R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]ethylidene]urea |
| SMILES | C[C@@H](O[C@@H]1OCCN(C/C(N)=N/C(N)=O)C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H23F7N4O3/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)37-20-19(13-2-4-17(24)5-3-13)34(6-7-36-20)11-18(31)33-21(32)35/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H4,31,32,33,35)/t12-,19?,20+/m1/s1 |
| InChIKey | MHVUQLKOZLUPQH-UTMDMGFZSA-N |
| XLogP | 4.78 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|