C23H23F7N4O3 — CID 10280285
5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1,2,4-triazolidin-3-one (PubChem CID 10280285) has the molecular formula C23H23F7N4O3 and a molecular weight of 536.45 g/mol. Its IUPAC name is 5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1,2,4-triazolidin-3-one.
| Compound Name | 5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 10280285 |
| Molecular Formula | C23H23F7N4O3 |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-1,2,4-triazolidin-3-one |
| SMILES | C[C@@H](O[C@H]1OCCN(CC2NNC(=O)N2)C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H23F7N4O3/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)37-20-19(13-2-4-17(24)5-3-13)34(6-7-36-20)11-18-31-21(35)33-32-18/h2-5,8-10,12,18-20,32H,6-7,11H2,1H3,(H2,31,33,35)/t12-,18?,19?,20-/m1/s1 |
| InChIKey | QVIGNUIBBZNSDB-LZTMVPNNSA-N |
| XLogP | 4.48 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |