C24H28F4N4O4 — CID 59593769
N-[(Z)-[1-amino-2-[(2R,3S)-3-(4-fluorophenyl)-2-[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]morpholin-4-yl]ethylidene]amino]-2-hydroxyacetamide (PubChem CID 59593769) has the molecular formula C24H28F4N4O4 and a molecular weight of 512.50 g/mol. Its IUPAC name is N-[(Z)-[1-amino-2-[(2R,3S)-3-(4-fluorophenyl)-2-[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]morpholin-4-yl]ethylidene]amino]-2-hydroxyacetamide.
| Compound Name | N-[(Z)-[1-amino-2-[(2R,3S)-3-(4-fluorophenyl)-2-[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]morpholin-4-yl]ethylidene]amino]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 59593769 |
| Molecular Formula | C24H28F4N4O4 |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | N-[(Z)-[1-amino-2-[(2R,3S)-3-(4-fluorophenyl)-2-[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]morpholin-4-yl]ethylidene]amino]-2-hydroxyacetamide |
| SMILES | Cc1cc([C@@H](C)O[C@H]2OCCN(C/C(N)=N/NC(=O)CO)C2c2ccc(F)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H28F4N4O4/c1-14-9-17(11-18(10-14)24(26,27)28)15(2)36-23-22(16-3-5-19(25)6-4-16)32(7-8-35-23)12-20(29)30-31-21(34)13-33/h3-6,9-11,15,22-23,33H,7-8,12-13H2,1-2H3,(H2,29,30)(H,31,34)/t15-,22?,23-/m1/s1 |
| InChIKey | MMEJGFFBEISMEC-FQFNWLPQSA-N |
| XLogP | 3.01 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|