C22H30O3S — CID 11111563
(2S)-2-[(1S)-1-hydroxyheptyl]-4-phenylsulfanyl-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 11111563) has the molecular formula C22H30O3S and a molecular weight of 374.55 g/mol. Its IUPAC name is (2S)-2-[(1S)-1-hydroxyheptyl]-4-phenylsulfanyl-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | (2S)-2-[(1S)-1-hydroxyheptyl]-4-phenylsulfanyl-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 11111563 |
| Molecular Formula | C22H30O3S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (2S)-2-[(1S)-1-hydroxyheptyl]-4-phenylsulfanyl-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CCCCCC[C@H](O)[C@@H]1CC(Sc2ccccc2)C2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C22H30O3S/c1-2-3-4-8-12-17(23)20-15-21(26-16-10-6-5-7-11-16)22-18(24)13-9-14-19(22)25-20/h5-7,10-11,17,20-21,23H,2-4,8-9,12-15H2,1H3/t17-,20-,21?/m0/s1 |
| InChIKey | DHRIPODYADBYEM-LTGDSAQFSA-N |
| XLogP | 5.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|