C25H36O4S — CID 11112862
2-[2-[(4S,5S)-5-hexyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylethyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 11112862) has the molecular formula C25H36O4S and a molecular weight of 432.63 g/mol. Its IUPAC name is 2-[2-[(4S,5S)-5-hexyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylethyl]-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[2-[(4S,5S)-5-hexyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylethyl]-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11112862 |
| Molecular Formula | C25H36O4S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-[2-[(4S,5S)-5-hexyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylethyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | CCCCCC[C@@H]1OC(C)(C)O[C@H]1CC(Sc1ccccc1)C1=C(O)CCCC1=O |
| InChI | InChI=1S/C25H36O4S/c1-4-5-6-10-16-21-22(29-25(2,3)28-21)17-23(30-18-12-8-7-9-13-18)24-19(26)14-11-15-20(24)27/h7-9,12-13,21-23,26H,4-6,10-11,14-17H2,1-3H3/t21-,22-,23?/m0/s1 |
| InChIKey | RMXLVBJUFKDOGD-OJSMNCEXSA-N |
| XLogP | 6.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|