C13H16BrN3O — CID 111118388
3-[[5-(4-bromophenyl)-1H-imidazol-2-yl]methylamino]propan-1-ol (PubChem CID 111118388) has the molecular formula C13H16BrN3O and a molecular weight of 310.19 g/mol. Its IUPAC name is 3-[[5-(4-bromophenyl)-1H-imidazol-2-yl]methylamino]propan-1-ol.
| Compound Name | 3-[[5-(4-bromophenyl)-1H-imidazol-2-yl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 111118388 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 3-[[5-(4-bromophenyl)-1H-imidazol-2-yl]methylamino]propan-1-ol |
| SMILES | OCCCNCc1ncc(-c2ccc(Br)cc2)[nH]1 |
| InChI | InChI=1S/C13H16BrN3O/c14-11-4-2-10(3-5-11)12-8-16-13(17-12)9-15-6-1-7-18/h2-5,8,15,18H,1,6-7,9H2,(H,16,17) |
| InChIKey | MTAOEUFVORRYLR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|