C18H22BrN5 — CID 119129489
N-[[5-(4-bromophenyl)-1H-imidazol-2-yl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine (PubChem CID 119129489) has the molecular formula C18H22BrN5 and a molecular weight of 388.31 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)-1H-imidazol-2-yl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine.
| Compound Name | N-[[5-(4-bromophenyl)-1H-imidazol-2-yl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 119129489 |
| Molecular Formula | C18H22BrN5 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[[5-(4-bromophenyl)-1H-imidazol-2-yl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C)c(C)c1CCNCc1ncc(-c2ccc(Br)cc2)[nH]1 |
| InChI | InChI=1S/C18H22BrN5/c1-12-16(13(2)24(3)23-12)8-9-20-11-18-21-10-17(22-18)14-4-6-15(19)7-5-14/h4-7,10,20H,8-9,11H2,1-3H3,(H,21,22) |
| InChIKey | SLLPOBDEUKBQMG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|