C17H23NO2 — CID 111119224
1-[[(2-hydroxy-3,3-dimethylbutyl)amino]methyl]naphthalen-2-ol (PubChem CID 111119224) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-[[(2-hydroxy-3,3-dimethylbutyl)amino]methyl]naphthalen-2-ol.
| Compound Name | 1-[[(2-hydroxy-3,3-dimethylbutyl)amino]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 111119224 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-[[(2-hydroxy-3,3-dimethylbutyl)amino]methyl]naphthalen-2-ol |
| SMILES | CC(C)(C)C(O)CNCc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C17H23NO2/c1-17(2,3)16(20)11-18-10-14-13-7-5-4-6-12(13)8-9-15(14)19/h4-9,16,18-20H,10-11H2,1-3H3 |
| InChIKey | MFIZFVKULHVXGW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|