C19H30N2O3 — CID 111120281
1-[3-[2-hydroxy-3-(4-propyl-1,4-diazepan-1-yl)propoxy]phenyl]ethanone (PubChem CID 111120281) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[3-[2-hydroxy-3-(4-propyl-1,4-diazepan-1-yl)propoxy]phenyl]ethanone.
| Compound Name | 1-[3-[2-hydroxy-3-(4-propyl-1,4-diazepan-1-yl)propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 111120281 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[3-[2-hydroxy-3-(4-propyl-1,4-diazepan-1-yl)propoxy]phenyl]ethanone |
| SMILES | CCCN1CCCN(CC(O)COc2cccc(C(C)=O)c2)CC1 |
| InChI | InChI=1S/C19H30N2O3/c1-3-8-20-9-5-10-21(12-11-20)14-18(23)15-24-19-7-4-6-17(13-19)16(2)22/h4,6-7,13,18,23H,3,5,8-12,14-15H2,1-2H3 |
| InChIKey | OIPZYCBIMWRBPN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |