C23H28N2O4 — CID 55346104
1-[4-[4-[3-(3-acetylphenoxy)-2-hydroxypropyl]piperazin-1-yl]phenyl]ethanone (PubChem CID 55346104) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[4-[4-[3-(3-acetylphenoxy)-2-hydroxypropyl]piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[3-(3-acetylphenoxy)-2-hydroxypropyl]piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 55346104 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[4-[4-[3-(3-acetylphenoxy)-2-hydroxypropyl]piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(CC(O)COc3cccc(C(C)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-17(26)19-6-8-21(9-7-19)25-12-10-24(11-13-25)15-22(28)16-29-23-5-3-4-20(14-23)18(2)27/h3-9,14,22,28H,10-13,15-16H2,1-2H3 |
| InChIKey | SWQUHMNROWJMDF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |