C15H20N4O — CID 111123466
1,2-dimethyl-3-(3-quinolin-8-yloxypropyl)guanidine (PubChem CID 111123466) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 1,2-dimethyl-3-(3-quinolin-8-yloxypropyl)guanidine.
| Compound Name | 1,2-dimethyl-3-(3-quinolin-8-yloxypropyl)guanidine |
|---|---|
| PubChem CID | 111123466 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1,2-dimethyl-3-(3-quinolin-8-yloxypropyl)guanidine |
| SMILES | C/N=C(\NC)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C15H20N4O/c1-16-15(17-2)19-10-5-11-20-13-8-3-6-12-7-4-9-18-14(12)13/h3-4,6-9H,5,10-11H2,1-2H3,(H2,16,17,19) |
| InChIKey | HVXMOSQCTZRSKG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|