C15H30N4O — CID 111123659
1,1,2-trimethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111123659) has the molecular formula C15H30N4O and a molecular weight of 282.43 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1,1,2-trimethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111123659 |
| Molecular Formula | C15H30N4O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 1,1,2-trimethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | C/N=C(/NCC1(N2CCOCC2)CCCCC1)N(C)C |
| InChI | InChI=1S/C15H30N4O/c1-16-14(18(2)3)17-13-15(7-5-4-6-8-15)19-9-11-20-12-10-19/h4-13H2,1-3H3,(H,16,17) |
| InChIKey | XGRFKEHODCIAMG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|