About 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide
1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide (PubChem CID 111126138) has the molecular formula C15H31IN4O
and a molecular weight of 410.34 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide |
| PubChem CID | 111126138 |
| Molecular Formula | C15H31IN4O |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N1CCCCC1C)NC(C)C.I |
| InChI | InChI=1S/C15H30N4O.HI/c1-5-16-15(18-12(2)3)17-10-9-14(20)19-11-7-6-8-13(19)4;/h12-13H,5-11H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | GHVZLKUQTBUKIS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide?
The IUPAC name of 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide (CID 111126138) is 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide.
What is the SMILES notation for 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide?
The canonical SMILES for 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide is CCN/C(=N\CCC(=O)N1CCCCC1C)NC(C)C.I.
What is the InChIKey of 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide?
The InChIKey is GHVZLKUQTBUKIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N4O.HI/c1-5-16-15(18-12(2)3)17-10-9-14(20)19-11-7-6-8-13(19)4;/h12-13H,5-11H2,1-4H3,(H2,16,17,18);1H.
What are the key properties of 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide?
1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide has a molecular weight of 410.34 g/mol, XLogP of 2.36, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]-3-propan-2-ylguanidine;hydroiodide is sourced from PubChem (CID 111126138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).