C19H21NO3SSe — CID 11112639
methyl (E,1E)-2-(methoxymethyl)-N-(4-methylphenyl)sulfonyl-3-phenylprop-2-enimidoselenoate (PubChem CID 11112639) has the molecular formula C19H21NO3SSe and a molecular weight of 422.41 g/mol. Its IUPAC name is methyl (E,1E)-2-(methoxymethyl)-N-(4-methylphenyl)sulfonyl-3-phenylprop-2-enimidoselenoate.
| Compound Name | methyl (E,1E)-2-(methoxymethyl)-N-(4-methylphenyl)sulfonyl-3-phenylprop-2-enimidoselenoate |
|---|---|
| PubChem CID | 11112639 |
| Molecular Formula | C19H21NO3SSe |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | methyl (E,1E)-2-(methoxymethyl)-N-(4-methylphenyl)sulfonyl-3-phenylprop-2-enimidoselenoate |
| SMILES | COCC(=C\c1ccccc1)/C(=N\S(=O)(=O)c1ccc(C)cc1)[Se]C |
| InChI | InChI=1S/C19H21NO3SSe/c1-15-9-11-18(12-10-15)24(21,22)20-19(25-3)17(14-23-2)13-16-7-5-4-6-8-16/h4-13H,14H2,1-3H3/b17-13+,20-19+ |
| InChIKey | FOQJRMCPJMBUFY-SXXHPKIYSA-N |
| XLogP | 3.56 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|