C28H34N4 — CID 11112736
(3S)-1,1-dibutyl-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 11112736) has the molecular formula C28H34N4 and a molecular weight of 426.61 g/mol. Its IUPAC name is (3S)-1,1-dibutyl-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (3S)-1,1-dibutyl-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11112736 |
| Molecular Formula | C28H34N4 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | (3S)-1,1-dibutyl-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCCC1(CCCC)N[C@H](c2ncc(-c3ccccc3)[nH]2)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C28H34N4/c1-3-5-16-28(17-6-4-2)26-22(21-14-10-11-15-23(21)30-26)18-24(32-28)27-29-19-25(31-27)20-12-8-7-9-13-20/h7-15,19,24,30,32H,3-6,16-18H2,1-2H3,(H,29,31)/t24-/m0/s1 |
| InChIKey | FOBFICSYUINKAA-DEOSSOPVSA-N |
| XLogP | 7.02 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |