C14H19ClF3N3O — CID 111131176
1-[(4-chlorophenyl)methyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111131176) has the molecular formula C14H19ClF3N3O and a molecular weight of 337.77 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111131176 |
| Molecular Formula | C14H19ClF3N3O |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClF3N3O/c1-19-13(20-7-2-8-22-10-14(16,17)18)21-9-11-3-5-12(15)6-4-11/h3-6H,2,7-10H2,1H3,(H2,19,20,21) |
| InChIKey | KOCDOUDWOKSEDI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|