C16H28N4O2 — CID 111136679
2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111136679) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111136679 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccco1)N(C)C)NCC1CCCO1 |
| InChI | InChI=1S/C16H28N4O2/c1-4-17-16(18-11-13-7-5-9-21-13)19-12-14(20(2)3)15-8-6-10-22-15/h6,8,10,13-14H,4-5,7,9,11-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | UTVDMWFCSBUARN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|