C18H32N4O — CID 110989727
1-cyclopentyl-2-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine (PubChem CID 110989727) has the molecular formula C18H32N4O and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-cyclopentyl-2-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine.
| Compound Name | 1-cyclopentyl-2-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 110989727 |
| Molecular Formula | C18H32N4O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 1-cyclopentyl-2-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(c1ccco1)N(CC)CC)NC1CCCC1 |
| InChI | InChI=1S/C18H32N4O/c1-4-19-18(21-15-10-7-8-11-15)20-14-16(22(5-2)6-3)17-12-9-13-23-17/h9,12-13,15-16H,4-8,10-11,14H2,1-3H3,(H2,19,20,21) |
| InChIKey | CGLIMHCICWWZNN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|