C20H38IN5O2 — CID 111941684
3-[[N'-[2-(diethylamino)-2-(furan-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111941684) has the molecular formula C20H38IN5O2 and a molecular weight of 507.46 g/mol. Its IUPAC name is 3-[[N'-[2-(diethylamino)-2-(furan-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[2-(diethylamino)-2-(furan-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111941684 |
| Molecular Formula | C20H38IN5O2 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 3-[[N'-[2-(diethylamino)-2-(furan-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccco1)N(CC)CC)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C20H37N5O2.HI/c1-6-21-20(22-14-13-19(26)25(9-4)10-5)23-16-17(24(7-2)8-3)18-12-11-15-27-18;/h11-12,15,17H,6-10,13-14,16H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | HZCBIWZXIOVNNV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|