C18H33N5O2 — CID 111941927
3-[[N'-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide (PubChem CID 111941927) has the molecular formula C18H33N5O2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 3-[[N'-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide.
| Compound Name | 3-[[N'-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 111941927 |
| Molecular Formula | C18H33N5O2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 3-[[N'-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide |
| SMILES | CCN/C(=N\CC(c1ccco1)N(C)C)NCCC(=O)N(CC)CC |
| InChI | InChI=1S/C18H33N5O2/c1-6-19-18(20-12-11-17(24)23(7-2)8-3)21-14-15(22(4)5)16-10-9-13-25-16/h9-10,13,15H,6-8,11-12,14H2,1-5H3,(H2,19,20,21) |
| InChIKey | BWKCZNQSWYKZQF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|