C22H30N6O — CID 111863842
2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine (PubChem CID 111863842) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine.
| Compound Name | 2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111863842 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccco1)N(C)C)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C22H30N6O/c1-4-23-22(25-17-20(27(2)3)21-7-5-16-29-21)24-14-12-18-8-10-19(11-9-18)28-15-6-13-26-28/h5-11,13,15-16,20H,4,12,14,17H2,1-3H3,(H2,23,24,25) |
| InChIKey | FMCRJBBKZOUXHT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|