C21H32N6 — CID 111863982
2-[2-cyclopropyl-2-(dimethylamino)ethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine (PubChem CID 111863982) has the molecular formula C21H32N6 and a molecular weight of 368.53 g/mol. Its IUPAC name is 2-[2-cyclopropyl-2-(dimethylamino)ethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine.
| Compound Name | 2-[2-cyclopropyl-2-(dimethylamino)ethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111863982 |
| Molecular Formula | C21H32N6 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2-[2-cyclopropyl-2-(dimethylamino)ethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C1CC1)N(C)C)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C21H32N6/c1-4-22-21(24-16-20(26(2)3)18-8-9-18)23-14-12-17-6-10-19(11-7-17)27-15-5-13-25-27/h5-7,10-11,13,15,18,20H,4,8-9,12,14,16H2,1-3H3,(H2,22,23,24) |
| InChIKey | YPIQFHPRSIRQLR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|