C22H26ClN5O — CID 111998323
2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine (PubChem CID 111998323) has the molecular formula C22H26ClN5O and a molecular weight of 411.94 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111998323 |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)cc1)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C22H26ClN5O/c1-2-24-22(26-16-21(29)18-6-8-19(23)9-7-18)25-14-12-17-4-10-20(11-5-17)28-15-3-13-27-28/h3-11,13,15,21,29H,2,12,14,16H2,1H3,(H2,24,25,26) |
| InChIKey | CQFLKCIHFAYZMC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|