C19H37IN4O3 — CID 111404746
2-[2-(diethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide (PubChem CID 111404746) has the molecular formula C19H37IN4O3 and a molecular weight of 496.43 g/mol. Its IUPAC name is 2-[2-(diethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(diethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111404746 |
| Molecular Formula | C19H37IN4O3 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-[2-(diethylamino)-2-(furan-2-yl)ethyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccco1)N(CC)CC)NCCCOCCOC.I |
| InChI | InChI=1S/C19H36N4O3.HI/c1-5-20-19(21-11-9-12-25-15-14-24-4)22-16-17(23(6-2)7-3)18-10-8-13-26-18;/h8,10,13,17H,5-7,9,11-12,14-16H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | FQVADGADWBSBQR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|