C12H23F3IN3O2 — CID 111137582
2-methyl-1-(oxolan-2-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111137582) has the molecular formula C12H23F3IN3O2 and a molecular weight of 425.23 g/mol. Its IUPAC name is 2-methyl-1-(oxolan-2-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111137582 |
| Molecular Formula | C12H23F3IN3O2 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)NCC1CCCO1.I |
| InChI | InChI=1S/C12H22F3N3O2.HI/c1-16-11(18-8-10-4-2-7-20-10)17-5-3-6-19-9-12(13,14)15;/h10H,2-9H2,1H3,(H2,16,17,18);1H |
| InChIKey | UXQBWBKELRXEOG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|