C27H32O9 — CID 11113849
tetraethyl 10-oxotetracyclo[7.6.0.01,12.03,7]pentadeca-2,7,11-triene-5,5,14,14-tetracarboxylate (PubChem CID 11113849) has the molecular formula C27H32O9 and a molecular weight of 500.54 g/mol. Its IUPAC name is tetraethyl 10-oxotetracyclo[7.6.0.01,12.03,7]pentadeca-2,7,11-triene-5,5,14,14-tetracarboxylate.
| Compound Name | tetraethyl 10-oxotetracyclo[7.6.0.01,12.03,7]pentadeca-2,7,11-triene-5,5,14,14-tetracarboxylate |
|---|---|
| PubChem CID | 11113849 |
| Molecular Formula | C27H32O9 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | tetraethyl 10-oxotetracyclo[7.6.0.01,12.03,7]pentadeca-2,7,11-triene-5,5,14,14-tetracarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=CC3C(=O)C=C4CC(C(=O)OCC)(C(=O)OCC)CC43C=C2C1 |
| InChI | InChI=1S/C27H32O9/c1-5-33-21(29)25(22(30)34-6-2)11-16-9-19-20(28)10-18-14-27(23(31)35-7-3,24(32)36-8-4)15-26(18,19)13-17(16)12-25/h9-10,13,19H,5-8,11-12,14-15H2,1-4H3 |
| InChIKey | AFDFYDDNGJBDBV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|