C18H27ClN4O3S — CID 111140835
1-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine (PubChem CID 111140835) has the molecular formula C18H27ClN4O3S and a molecular weight of 414.96 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine.
| Compound Name | 1-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111140835 |
| Molecular Formula | C18H27ClN4O3S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
| SMILES | C/N=C(\NCC(c1ccccc1Cl)N1CCOCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H27ClN4O3S/c1-20-18(22-14-6-11-27(24,25)13-14)21-12-17(23-7-9-26-10-8-23)15-4-2-3-5-16(15)19/h2-5,14,17H,6-13H2,1H3,(H2,20,21,22) |
| InChIKey | WRQPJGRXKZPDSB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|