C16H32IN5O3S — CID 111143249
1-[3-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide (PubChem CID 111143249) has the molecular formula C16H32IN5O3S and a molecular weight of 501.44 g/mol. Its IUPAC name is 1-[3-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111143249 |
| Molecular Formula | C16H32IN5O3S |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 1-[3-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCN1CCCC1C(=O)N(C)C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H31N5O3S.HI/c1-17-16(19-13-7-11-25(23,24)12-13)18-8-5-10-21-9-4-6-14(21)15(22)20(2)3;/h13-14H,4-12H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | NUFSGETUMKTMBI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|