C16H33N5O — CID 110945294
1-[3-[(N-butan-2-yl-N'-methylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 110945294) has the molecular formula C16H33N5O and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-[3-[(N-butan-2-yl-N'-methylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[(N-butan-2-yl-N'-methylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110945294 |
| Molecular Formula | C16H33N5O |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.27 |
| IUPAC Name | 1-[3-[(N-butan-2-yl-N'-methylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CCC(C)N/C(=N\C)NCCCN1CCCC1C(=O)N(C)C |
| InChI | InChI=1S/C16H33N5O/c1-6-13(2)19-16(17-3)18-10-8-12-21-11-7-9-14(21)15(22)20(4)5/h13-14H,6-12H2,1-5H3,(H2,17,18,19) |
| InChIKey | PCNNUTAOEXQCKB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|