C20H39N5O3 — CID 111408597
N,N-dimethyl-1-[3-[[N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide (PubChem CID 111408597) has the molecular formula C20H39N5O3 and a molecular weight of 397.56 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-[[N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide.
| Compound Name | N,N-dimethyl-1-[3-[[N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111408597 |
| Molecular Formula | C20H39N5O3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | N,N-dimethyl-1-[3-[[N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]carbamimidoyl]amino]propyl]pyrrolidine-2-carboxamide |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCCCN1CCCC1C(=O)N(C)C |
| InChI | InChI=1S/C20H39N5O3/c1-21-20(23-11-7-14-27-16-17-8-5-15-28-17)22-10-6-13-25-12-4-9-18(25)19(26)24(2)3/h17-18H,4-16H2,1-3H3,(H2,21,22,23) |
| InChIKey | RUWSJORDGBALHE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|