C23H46N6O2 — CID 111936731
1-[3-[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 111936731) has the molecular formula C23H46N6O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 1-[3-[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111936731 |
| Molecular Formula | C23H46N6O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | 1-[3-[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CCC(CC)C(CN/C(=N/C)NCCCN1CCCC1C(=O)N(C)C)N1CCOCC1 |
| InChI | InChI=1S/C23H46N6O2/c1-6-19(7-2)21(29-14-16-31-17-15-29)18-26-23(24-3)25-11-9-13-28-12-8-10-20(28)22(30)27(4)5/h19-21H,6-18H2,1-5H3,(H2,24,25,26) |
| InChIKey | XGECRXDCZNVXEA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|