C14H25N5 — CID 111143810
N',3-dimethyl-N-(3-pyrazol-1-ylpropyl)piperidine-1-carboximidamide (PubChem CID 111143810) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is N',3-dimethyl-N-(3-pyrazol-1-ylpropyl)piperidine-1-carboximidamide.
| Compound Name | N',3-dimethyl-N-(3-pyrazol-1-ylpropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111143810 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | N',3-dimethyl-N-(3-pyrazol-1-ylpropyl)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCn1cccn1)N1CCCC(C)C1 |
| InChI | InChI=1S/C14H25N5/c1-13-6-3-9-18(12-13)14(15-2)16-7-4-10-19-11-5-8-17-19/h5,8,11,13H,3-4,6-7,9-10,12H2,1-2H3,(H,15,16) |
| InChIKey | ODMDFJUVRRWUOO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|