C18H29N3O — CID 111143828
N-ethyl-N'-[[3-(methoxymethyl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111143828) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is N-ethyl-N'-[[3-(methoxymethyl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[3-(methoxymethyl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111143828 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | N-ethyl-N'-[[3-(methoxymethyl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(COC)c1)N1CCCC(C)C1 |
| InChI | InChI=1S/C18H29N3O/c1-4-19-18(21-10-6-7-15(2)13-21)20-12-16-8-5-9-17(11-16)14-22-3/h5,8-9,11,15H,4,6-7,10,12-14H2,1-3H3,(H,19,20) |
| InChIKey | DGYPZAPFKIOVKR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|