C16H32IN3O — CID 111144259
N-ethyl-N'-[(1-hydroxycyclohexyl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111144259) has the molecular formula C16H32IN3O and a molecular weight of 409.36 g/mol. Its IUPAC name is N-ethyl-N'-[(1-hydroxycyclohexyl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(1-hydroxycyclohexyl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111144259 |
| Molecular Formula | C16H32IN3O |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-ethyl-N'-[(1-hydroxycyclohexyl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(O)CCCCC1)N1CCCC(C)C1.I |
| InChI | InChI=1S/C16H31N3O.HI/c1-3-17-15(19-11-7-8-14(2)12-19)18-13-16(20)9-5-4-6-10-16;/h14,20H,3-13H2,1-2H3,(H,17,18);1H |
| InChIKey | VWKQFBKSWBFQLI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|