C12H22IN3 — CID 111144659
N-ethyl-3-methyl-N'-prop-2-ynylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111144659) has the molecular formula C12H22IN3 and a molecular weight of 335.23 g/mol. Its IUPAC name is N-ethyl-3-methyl-N'-prop-2-ynylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-methyl-N'-prop-2-ynylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111144659 |
| Molecular Formula | C12H22IN3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-ethyl-3-methyl-N'-prop-2-ynylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | C#CC/N=C(\NCC)N1CCCC(C)C1.I |
| InChI | InChI=1S/C12H21N3.HI/c1-4-8-14-12(13-5-2)15-9-6-7-11(3)10-15;/h1,11H,5-10H2,2-3H3,(H,13,14);1H |
| InChIKey | JAFIJYLEUPHRQQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|