C14H30N4 — CID 111144884
N-ethyl-N'-[2-[ethyl(methyl)amino]ethyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111144884) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is N-ethyl-N'-[2-[ethyl(methyl)amino]ethyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[ethyl(methyl)amino]ethyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111144884 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | N-ethyl-N'-[2-[ethyl(methyl)amino]ethyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN(C)CC)N1CCCC(C)C1 |
| InChI | InChI=1S/C14H30N4/c1-5-15-14(16-9-11-17(4)6-2)18-10-7-8-13(3)12-18/h13H,5-12H2,1-4H3,(H,15,16) |
| InChIKey | HSBGOAGNRSVFPO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|