C18H29N3 — CID 111144474
N',3-dimethyl-N-(2-methyl-2-phenylpropyl)piperidine-1-carboximidamide (PubChem CID 111144474) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is N',3-dimethyl-N-(2-methyl-2-phenylpropyl)piperidine-1-carboximidamide.
| Compound Name | N',3-dimethyl-N-(2-methyl-2-phenylpropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111144474 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | N',3-dimethyl-N-(2-methyl-2-phenylpropyl)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)(C)c1ccccc1)N1CCCC(C)C1 |
| InChI | InChI=1S/C18H29N3/c1-15-9-8-12-21(13-15)17(19-4)20-14-18(2,3)16-10-6-5-7-11-16/h5-7,10-11,15H,8-9,12-14H2,1-4H3,(H,19,20) |
| InChIKey | YFASHYLBZURWKU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|